Joinplease Joinplease

03-12-2021
History

contestada

Ancient Greece lasted from 5000 BCE to 150 BCE.
true or false

Respuesta :

jordyncupp jordyncupp

03-12-2021

Answer:

false

Explanation:

ancient Greece from its emergence around 800 BC to its subjection to the Roman Empire in 146 BC

Answer Link

Otras preguntas

Photosynthesis can be broken down into two steps; the light and dark reactions. The dark reaction is also known as mo nga ana in certain the sun centenas bonnes

24 jelly sandwiches are made with a 16-ounce jar of jelly, How many ounces of jelly per sandwich is that?

Protein sources include seafood, eggs, nuts, soy products, and lean meats and poultry. Select one: True False

Displacement is to velocity as_____is to acceleration

What is sustainable development practice? How is this related to PNW Salmon and dams?

Tim sold half of his comics collection and then bought 16 more. If he now has 36, how many did he begin with?

cosec(6b+pi/8)=sec(2b-pi/8)

Use the distributive property to remove the parentheses. -4(-8 + 6)

What is the function of NADPH and ATP in the Calvin cycle? • A They provide the energy required to build high-energy sugars B. They provide the energy to create

If a device does not require a driver, it is _____. A quickset B plug and play C hyperconnected