mchaudhry22 mchaudhry22

02-02-2021
Mathematics

contestada

The weight of an object on the moon is 1/6 its weight on earth. If a bowling ball weighs 12 and 1/2 pounds on earth, how much does it weigh on the moon?

Respuesta :

reguser315 reguser315

02-02-2021

12.5/6=2.08 pounds on the moon

Answer Link

Otras preguntas

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

An aerosol topical dose form should be used when? a. rubbing is desire b. the site of application c. the drug must be inhaled d. the drug must penetrate the

Approximately how much is spent on campaign polling annually in the united states?

which of the following cannot be created using word software ?

how did the louisiana purchase lead to economic benefits for american farmers living in the ohio river valley

Last One.....Which additional words should be capitalized in the sentence? For class I read the poem "if you forget me." Choose all answers that are correct. A

what is 9.6 is ten times as much as

Solve the equation y=mx+b for x I don't understand what it's asking

John baptized in the sea of Galilee. True False

If the whole bar is 3 units long, what is the length of the shaded part of the bar? Write a multiplication equation for the diagram and solve.